
CAS:257280-25-4|5-Bromo-2-phenoxypyrimidine
Molecular Formula:C10H7BrN2O
Molecular Weight:251.08 g/mol
Purity:98 percent
Package:100g/250g/500g/1kg/bulk package
- दुनिया भर में डिलीवरी
- गुणवत्ता आश्वासन
- 24/7 ग्राहक सेवा
उत्पाद का परिचय
5-Bromo-2-phenoxypyrimidine has been used in a variety of scientific research applications. It has been used in the study of enzyme inhibition, protein-protein interactions, and other biochemical and physiological processes. It has also been used as a fluorescent probe for the detection of various biomolecules, such as DNA and proteins. 5-Bromo-2-phenoxypyrimidine has also been used in the synthesis of various dyes, pharmaceuticals, and other organic compounds.
|
|
|
| 5-bromo-2-phenoxypyrimidine | |
| MFCD03646346 | |
| 1.543g/cm3 | |
| 366.7ºC at 760 mmHg | |
| 35.01 | |
| 3.03 | |
| InChI=1S/C10H7BrN2O/c11-8-6-12-10(13-7-8)14-9-4-2-1-3-5-9/h1-7H | |
| ZFECRMYYOMVREH-UHFFFAOYSA-N |

लोकप्रिय टैग: cas:257280-25-4|5-bromo-2-phenoxypyrimidine, price, quotation, discount, in stock, for sale






